C18H12BrN5O4S — CID 2890108
6-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2-ethyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 2890108) has the molecular formula C18H12BrN5O4S and a molecular weight of 474.30 g/mol. Its IUPAC name is 6-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2-ethyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2-ethyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 2890108 |
| Molecular Formula | C18H12BrN5O4S |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 472.98 |
| IUPAC Name | 6-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2-ethyl-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(-c3ccc([N+](=O)[O-])cc3Br)o2)C(=O)N=C2SC(CC)=NN21 |
| InChI | InChI=1S/C18H12BrN5O4S/c1-2-15-22-23-16(20)12(17(25)21-18(23)29-15)8-10-4-6-14(28-10)11-5-3-9(24(26)27)7-13(11)19/h3-8,20H,2H2,1H3/b12-8?,20-16+ |
| InChIKey | TYVARSZYZGVXTM-UDIBLGMTSA-N |
| XLogP | 4.65 |
| TPSA | 125.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|