C30H25N5O2S — CID 22306294
(6E)-5-imino-2-[(2-methylphenoxy)methyl]-6-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 22306294) has the molecular formula C30H25N5O2S and a molecular weight of 519.63 g/mol. Its IUPAC name is (6E)-5-imino-2-[(2-methylphenoxy)methyl]-6-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-5-imino-2-[(2-methylphenoxy)methyl]-6-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 22306294 |
| Molecular Formula | C30H25N5O2S |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | (6E)-5-imino-2-[(2-methylphenoxy)methyl]-6-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2cn(Cc3ccccc3C)c3ccccc23)/C(=O)N=C2SC(COc3ccccc3C)=NN2/1 |
| InChI | InChI=1S/C30H25N5O2S/c1-19-9-3-5-11-21(19)16-34-17-22(23-12-6-7-13-25(23)34)15-24-28(31)35-30(32-29(24)36)38-27(33-35)18-37-26-14-8-4-10-20(26)2/h3-15,17,31H,16,18H2,1-2H3/b24-15+,31-28- |
| InChIKey | YQQFLKZWOVLDQH-OCBWHMNCSA-N |
| XLogP | 6.00 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|