C31H27N5O2S2 — CID 4920958
2-benzylsulfanyl-5-imino-6-[[1-[3-(2-methylphenoxy)propyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 4920958) has the molecular formula C31H27N5O2S2 and a molecular weight of 565.72 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-imino-6-[[1-[3-(2-methylphenoxy)propyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 2-benzylsulfanyl-5-imino-6-[[1-[3-(2-methylphenoxy)propyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4920958 |
| Molecular Formula | C31H27N5O2S2 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | 2-benzylsulfanyl-5-imino-6-[[1-[3-(2-methylphenoxy)propyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2cn(CCCOc3ccccc3C)c3ccccc23)C(=O)N=C2SC(SCc3ccccc3)=NN21 |
| InChI | InChI=1S/C31H27N5O2S2/c1-21-10-5-8-15-27(21)38-17-9-16-35-19-23(24-13-6-7-14-26(24)35)18-25-28(32)36-30(33-29(25)37)40-31(34-36)39-20-22-11-3-2-4-12-22/h2-8,10-15,18-19,32H,9,16-17,20H2,1H3/b25-18?,32-28- |
| InChIKey | INJUNGSWUDQFTG-PCRJCPDBSA-N |
| XLogP | 6.93 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|