C30H25N5O3S2 — CID 4871815
2-benzylsulfanyl-5-imino-6-[[1-[2-(2-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 4871815) has the molecular formula C30H25N5O3S2 and a molecular weight of 567.70 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-imino-6-[[1-[2-(2-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 2-benzylsulfanyl-5-imino-6-[[1-[2-(2-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4871815 |
| Molecular Formula | C30H25N5O3S2 |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | 2-benzylsulfanyl-5-imino-6-[[1-[2-(2-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2cn(CCOc3ccccc3OC)c3ccccc23)C(=O)N=C2SC(SCc3ccccc3)=NN21 |
| InChI | InChI=1S/C30H25N5O3S2/c1-37-25-13-7-8-14-26(25)38-16-15-34-18-21(22-11-5-6-12-24(22)34)17-23-27(31)35-29(32-28(23)36)40-30(33-35)39-19-20-9-3-2-4-10-20/h2-14,17-18,31H,15-16,19H2,1H3/b23-17?,31-27- |
| InChIKey | RJMAHCYUHWVJCE-YZIOJCGUSA-N |
| XLogP | 6.24 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|