C28H29N5O2S — CID 3822741
5-imino-6-[[1-[2-(4-methylphenoxy)ethyl]indol-3-yl]methylidene]-2-pentan-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3822741) has the molecular formula C28H29N5O2S and a molecular weight of 499.64 g/mol. Its IUPAC name is 5-imino-6-[[1-[2-(4-methylphenoxy)ethyl]indol-3-yl]methylidene]-2-pentan-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 5-imino-6-[[1-[2-(4-methylphenoxy)ethyl]indol-3-yl]methylidene]-2-pentan-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3822741 |
| Molecular Formula | C28H29N5O2S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 5-imino-6-[[1-[2-(4-methylphenoxy)ethyl]indol-3-yl]methylidene]-2-pentan-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2cn(CCOc3ccc(C)cc3)c3ccccc23)C(=O)N=C2SC(C(CC)CC)=NN21 |
| InChI | InChI=1S/C28H29N5O2S/c1-4-19(5-2)27-31-33-25(29)23(26(34)30-28(33)36-27)16-20-17-32(24-9-7-6-8-22(20)24)14-15-35-21-12-10-18(3)11-13-21/h6-13,16-17,19,29H,4-5,14-15H2,1-3H3/b23-16?,29-25- |
| InChIKey | LBEHSNMUDOWEMI-NMACSGRISA-N |
| XLogP | 6.08 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|