C19H16N4O4S — CID 4895236
5-imino-6-[(6-methoxy-4-oxochromen-3-yl)methylidene]-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 4895236) has the molecular formula C19H16N4O4S and a molecular weight of 396.43 g/mol. Its IUPAC name is 5-imino-6-[(6-methoxy-4-oxochromen-3-yl)methylidene]-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 5-imino-6-[(6-methoxy-4-oxochromen-3-yl)methylidene]-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4895236 |
| Molecular Formula | C19H16N4O4S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 5-imino-6-[(6-methoxy-4-oxochromen-3-yl)methylidene]-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2coc3ccc(OC)cc3c2=O)C(=O)N=C2SC(C(C)C)=NN21 |
| InChI | InChI=1S/C19H16N4O4S/c1-9(2)18-22-23-16(20)13(17(25)21-19(23)28-18)6-10-8-27-14-5-4-11(26-3)7-12(14)15(10)24/h4-9,20H,1-3H3/b13-6?,20-16- |
| InChIKey | OPLDFFRIGJTDBH-ICZXSLMVSA-N |
| XLogP | 3.08 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|