C15H8N4O3S — CID 2027562
(6Z)-5-imino-6-[(4-oxochromen-3-yl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 2027562) has the molecular formula C15H8N4O3S and a molecular weight of 324.32 g/mol. Its IUPAC name is (6Z)-5-imino-6-[(4-oxochromen-3-yl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-5-imino-6-[(4-oxochromen-3-yl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 2027562 |
| Molecular Formula | C15H8N4O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | (6Z)-5-imino-6-[(4-oxochromen-3-yl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2coc3ccccc3c2=O)/C(=O)N=C2SC=NN2/1 |
| InChI | InChI=1S/C15H8N4O3S/c16-13-10(14(21)18-15-19(13)17-7-23-15)5-8-6-22-11-4-2-1-3-9(11)12(8)20/h1-7,16H/b10-5-,16-13- |
| InChIKey | FJAJNDQHDCPAKD-MVBCBTCESA-N |
| XLogP | 2.04 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|