C17H11N3O4 — CID 4886012
7-imino-2-methyl-6-[(4-oxochromen-3-yl)methylidene]-[1,2]oxazolo[2,3-a]pyrimidin-5-one (PubChem CID 4886012) has the molecular formula C17H11N3O4 and a molecular weight of 321.29 g/mol. Its IUPAC name is 7-imino-2-methyl-6-[(4-oxochromen-3-yl)methylidene]-[1,2]oxazolo[2,3-a]pyrimidin-5-one.
| Compound Name | 7-imino-2-methyl-6-[(4-oxochromen-3-yl)methylidene]-[1,2]oxazolo[2,3-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 4886012 |
| Molecular Formula | C17H11N3O4 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 7-imino-2-methyl-6-[(4-oxochromen-3-yl)methylidene]-[1,2]oxazolo[2,3-a]pyrimidin-5-one |
| SMILES | [H]/N=C1/C(=Cc2coc3ccccc3c2=O)C(=O)N=C2C=C(C)ON21 |
| InChI | InChI=1S/C17H11N3O4/c1-9-6-14-19-17(22)12(16(18)20(14)24-9)7-10-8-23-13-5-3-2-4-11(13)15(10)21/h2-8,18H,1H3/b12-7?,18-16- |
| InChIKey | YSVKZGVYOAAPJA-YMZKLEIESA-N |
| XLogP | 2.24 |
| TPSA | 95.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|