C22H13N3O3S — CID 46258238
(6Z)-5-imino-6-[(4-oxochromen-3-yl)methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 46258238) has the molecular formula C22H13N3O3S and a molecular weight of 399.43 g/mol. Its IUPAC name is (6Z)-5-imino-6-[(4-oxochromen-3-yl)methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-5-imino-6-[(4-oxochromen-3-yl)methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46258238 |
| Molecular Formula | C22H13N3O3S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | (6Z)-5-imino-6-[(4-oxochromen-3-yl)methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2coc3ccccc3c2=O)\C(=O)N=C2SC=C(c3ccccc3)N2\1 |
| InChI | InChI=1S/C22H13N3O3S/c23-20-16(10-14-11-28-18-9-5-4-8-15(18)19(14)26)21(27)24-22-25(20)17(12-29-22)13-6-2-1-3-7-13/h1-12,23H/b16-10-,23-20+ |
| InChIKey | YVIHDTXUSXQJEE-REQWNXGKSA-N |
| XLogP | 4.10 |
| TPSA | 86.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|