C29H21ClN4O2S — CID 3502642
6-[[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3502642) has the molecular formula C29H21ClN4O2S and a molecular weight of 525.03 g/mol. Its IUPAC name is 6-[[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3502642 |
| Molecular Formula | C29H21ClN4O2S |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | 6-[[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2cn(CCOc3ccccc3Cl)c3ccccc23)C(=O)N=C2SC=C(c3ccccc3)N21 |
| InChI | InChI=1S/C29H21ClN4O2S/c30-23-11-5-7-13-26(23)36-15-14-33-17-20(21-10-4-6-12-24(21)33)16-22-27(31)34-25(19-8-2-1-3-9-19)18-37-29(34)32-28(22)35/h1-13,16-18,31H,14-15H2/b22-16?,31-27+ |
| InChIKey | YKYZQCDMMJPWRF-UCSCNDAUSA-N |
| XLogP | 6.68 |
| TPSA | 70.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|