C32H22N4OS — CID 3494800
5-imino-6-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3494800) has the molecular formula C32H22N4OS and a molecular weight of 510.62 g/mol. Its IUPAC name is 5-imino-6-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 5-imino-6-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3494800 |
| Molecular Formula | C32H22N4OS |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 5-imino-6-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2cn(Cc3cccc4ccccc34)c3ccccc23)C(=O)N=C2SC=C(c3ccccc3)N21 |
| InChI | InChI=1S/C32H22N4OS/c33-30-27(31(37)34-32-36(30)29(20-38-32)22-10-2-1-3-11-22)17-24-19-35(28-16-7-6-15-26(24)28)18-23-13-8-12-21-9-4-5-14-25(21)23/h1-17,19-20,33H,18H2/b27-17?,33-30+ |
| InChIKey | FAGONWOQRBNXSG-BYKRNRKGSA-N |
| XLogP | 7.15 |
| TPSA | 61.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|