C17H10N4O4S — CID 1334065
5-imino-6-[(5-nitrofuran-2-yl)methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 1334065) has the molecular formula C17H10N4O4S and a molecular weight of 366.36 g/mol. Its IUPAC name is 5-imino-6-[(5-nitrofuran-2-yl)methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 5-imino-6-[(5-nitrofuran-2-yl)methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 1334065 |
| Molecular Formula | C17H10N4O4S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 5-imino-6-[(5-nitrofuran-2-yl)methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc([N+](=O)[O-])o2)C(=O)N=C2SC=C(c3ccccc3)N21 |
| InChI | InChI=1S/C17H10N4O4S/c18-15-12(8-11-6-7-14(25-11)21(23)24)16(22)19-17-20(15)13(9-26-17)10-4-2-1-3-5-10/h1-9,18H/b12-8?,18-15+ |
| InChIKey | UUVYXCMXHCSQLD-ZHIRMJCCSA-N |
| XLogP | 3.49 |
| TPSA | 112.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|