C23H15N5O3S — CID 46253106
(6Z)-5-imino-6-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 46253106) has the molecular formula C23H15N5O3S and a molecular weight of 441.47 g/mol. Its IUPAC name is (6Z)-5-imino-6-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-5-imino-6-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46253106 |
| Molecular Formula | C23H15N5O3S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | (6Z)-5-imino-6-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2cccn2-c2ccc([N+](=O)[O-])cc2)\C(=O)N=C2SC=C(c3ccccc3)N2\1 |
| InChI | InChI=1S/C23H15N5O3S/c24-21-19(13-18-7-4-12-26(18)16-8-10-17(11-9-16)28(30)31)22(29)25-23-27(21)20(14-32-23)15-5-2-1-3-6-15/h1-14,24H/b19-13-,24-21+ |
| InChIKey | WZARZCDKLIEJMQ-RXBBGTROSA-N |
| XLogP | 4.69 |
| TPSA | 104.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|