C12H9N5O6S2 — CID 46252707
(6E)-2-ethylsulfonyl-5-imino-6-[(5-nitrofuran-2-yl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 46252707) has the molecular formula C12H9N5O6S2 and a molecular weight of 383.37 g/mol. Its IUPAC name is (6E)-2-ethylsulfonyl-5-imino-6-[(5-nitrofuran-2-yl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-2-ethylsulfonyl-5-imino-6-[(5-nitrofuran-2-yl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46252707 |
| Molecular Formula | C12H9N5O6S2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | (6E)-2-ethylsulfonyl-5-imino-6-[(5-nitrofuran-2-yl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2ccc([N+](=O)[O-])o2)/C(=O)N=C2SC(S(=O)(=O)CC)=NN2/1 |
| InChI | InChI=1S/C12H9N5O6S2/c1-2-25(21,22)12-15-16-9(13)7(10(18)14-11(16)24-12)5-6-3-4-8(23-6)17(19)20/h3-5,13H,2H2,1H3/b7-5+,13-9- |
| InChIKey | KKDZISKAXMFTDP-HUZLQASOSA-N |
| XLogP | 1.20 |
| TPSA | 159.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|