C21H18N4O7S3 — CID 56727276
[4-[(Z)-(2-ethylsulfonyl-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 56727276) has the molecular formula C21H18N4O7S3 and a molecular weight of 534.60 g/mol. Its IUPAC name is [4-[(Z)-(2-ethylsulfonyl-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [4-[(Z)-(2-ethylsulfonyl-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 56727276 |
| Molecular Formula | C21H18N4O7S3 |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.03 |
| IUPAC Name | [4-[(Z)-(2-ethylsulfonyl-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | [H]/N=C1C(=C/c2ccc(OS(=O)(=O)c3ccc(OC)cc3)cc2)/C(=O)N=C2SC(S(=O)(=O)CC)=NN2/1 |
| InChI | InChI=1S/C21H18N4O7S3/c1-3-34(27,28)21-24-25-18(22)17(19(26)23-20(25)33-21)12-13-4-6-15(7-5-13)32-35(29,30)16-10-8-14(31-2)9-11-16/h4-12,22H,3H2,1-2H3/b17-12-,22-18- |
| InChIKey | XUGUPWLCEFKMOR-RAHLPMSYSA-N |
| XLogP | 2.47 |
| TPSA | 155.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|