C22H20N4O6S3 — CID 56727312
[4-[(Z)-[5-imino-2-(2-methylpropylsulfonyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] benzenesulfonate (PubChem CID 56727312) has the molecular formula C22H20N4O6S3 and a molecular weight of 532.63 g/mol. Its IUPAC name is [4-[(Z)-[5-imino-2-(2-methylpropylsulfonyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [4-[(Z)-[5-imino-2-(2-methylpropylsulfonyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 56727312 |
| Molecular Formula | C22H20N4O6S3 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | [4-[(Z)-[5-imino-2-(2-methylpropylsulfonyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] benzenesulfonate |
| SMILES | [H]/N=C1C(=C/c2ccc(OS(=O)(=O)c3ccccc3)cc2)/C(=O)N=C2SC(S(=O)(=O)CC(C)C)=NN2/1 |
| InChI | InChI=1S/C22H20N4O6S3/c1-14(2)13-34(28,29)22-25-26-19(23)18(20(27)24-21(26)33-22)12-15-8-10-16(11-9-15)32-35(30,31)17-6-4-3-5-7-17/h3-12,14,23H,13H2,1-2H3/b18-12-,23-19- |
| InChIKey | VEQVFPGRJLUUBC-MEKYTMMYSA-N |
| XLogP | 3.10 |
| TPSA | 146.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|