C21H18N4O4S2 — CID 35209941
[4-[(Z)-(5-imino-7-oxo-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzenesulfonate (PubChem CID 35209941) has the molecular formula C21H18N4O4S2 and a molecular weight of 454.53 g/mol. Its IUPAC name is [4-[(Z)-(5-imino-7-oxo-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzenesulfonate.
| Compound Name | [4-[(Z)-(5-imino-7-oxo-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 35209941 |
| Molecular Formula | C21H18N4O4S2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | [4-[(Z)-(5-imino-7-oxo-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzenesulfonate |
| SMILES | [H]/N=C1C(=C/c2ccc(OS(=O)(=O)c3ccccc3)cc2)/C(=O)N=C2SC(C(C)C)=NN2/1 |
| InChI | InChI=1S/C21H18N4O4S2/c1-13(2)20-24-25-18(22)17(19(26)23-21(25)30-20)12-14-8-10-15(11-9-14)29-31(27,28)16-6-4-3-5-7-16/h3-13,22H,1-2H3/b17-12-,22-18- |
| InChIKey | DFUVHNRHCFWBRT-RAHLPMSYSA-N |
| XLogP | 3.73 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|