C22H20N4O4S2 — CID 6148414
[3-[(Z)-(5-imino-7-oxo-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 6148414) has the molecular formula C22H20N4O4S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is [3-[(Z)-(5-imino-7-oxo-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [3-[(Z)-(5-imino-7-oxo-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 6148414 |
| Molecular Formula | C22H20N4O4S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | [3-[(Z)-(5-imino-7-oxo-2-propan-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | [H]/N=C1C(=C/c2cccc(OS(=O)(=O)c3ccc(C)cc3)c2)/C(=O)N=C2SC(C(C)C)=NN2/1 |
| InChI | InChI=1S/C22H20N4O4S2/c1-13(2)21-25-26-19(23)18(20(27)24-22(26)31-21)12-15-5-4-6-16(11-15)30-32(28,29)17-9-7-14(3)8-10-17/h4-13,23H,1-3H3/b18-12-,23-19- |
| InChIKey | FYJWXMGBPOFXRZ-MEKYTMMYSA-N |
| XLogP | 4.04 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|