C24H24N4O4S2 — CID 3720395
[4-[(5-imino-7-oxo-2-pentan-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 3720395) has the molecular formula C24H24N4O4S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is [4-[(5-imino-7-oxo-2-pentan-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(5-imino-7-oxo-2-pentan-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 3720395 |
| Molecular Formula | C24H24N4O4S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | [4-[(5-imino-7-oxo-2-pentan-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | [H]/N=C1\C(=Cc2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)C(=O)N=C2SC(C(CC)CC)=NN21 |
| InChI | InChI=1S/C24H24N4O4S2/c1-4-17(5-2)23-27-28-21(25)20(22(29)26-24(28)33-23)14-16-8-10-18(11-9-16)32-34(30,31)19-12-6-15(3)7-13-19/h6-14,17,25H,4-5H2,1-3H3/b20-14?,25-21+ |
| InChIKey | ZZPSESLTDFMKQU-UAVACDPMSA-N |
| XLogP | 4.82 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|