C24H17N5O5S2 — CID 3559973
[4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 3559973) has the molecular formula C24H17N5O5S2 and a molecular weight of 519.56 g/mol. Its IUPAC name is [4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 3559973 |
| Molecular Formula | C24H17N5O5S2 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | [4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | [H]/N=C1\C(=Cc2ccc(OS(=O)(=O)c3ccc(OC)cc3)cc2)C(=O)N=C2SC(c3cccnc3)=NN21 |
| InChI | InChI=1S/C24H17N5O5S2/c1-33-17-8-10-19(11-9-17)36(31,32)34-18-6-4-15(5-7-18)13-20-21(25)29-24(27-22(20)30)35-23(28-29)16-3-2-12-26-14-16/h2-14,25H,1H3/b20-13?,25-21+ |
| InChIKey | VXNLBGIIEMZSIZ-FIOCIPRISA-N |
| XLogP | 3.53 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|