C25H19N5O5S2 — CID 2007576
[2-ethoxy-4-[(Z)-(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzenesulfonate (PubChem CID 2007576) has the molecular formula C25H19N5O5S2 and a molecular weight of 533.59 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzenesulfonate.
| Compound Name | [2-ethoxy-4-[(Z)-(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 2007576 |
| Molecular Formula | C25H19N5O5S2 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | [2-ethoxy-4-[(Z)-(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzenesulfonate |
| SMILES | [H]/N=C1C(=C/c2ccc(OS(=O)(=O)c3ccccc3)c(OCC)c2)/C(=O)N=C2SC(c3cccnc3)=NN2/1 |
| InChI | InChI=1S/C25H19N5O5S2/c1-2-34-21-14-16(10-11-20(21)35-37(32,33)18-8-4-3-5-9-18)13-19-22(26)30-25(28-23(19)31)36-24(29-30)17-7-6-12-27-15-17/h3-15,26H,2H2,1H3/b19-13-,26-22- |
| InChIKey | PODBFRLDDZGJIJ-NHTQPURVSA-N |
| XLogP | 3.92 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|