C18H13N5O4S2 — CID 2003441
[4-[(Z)-(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] methanesulfonate (PubChem CID 2003441) has the molecular formula C18H13N5O4S2 and a molecular weight of 427.47 g/mol. Its IUPAC name is [4-[(Z)-(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] methanesulfonate.
| Compound Name | [4-[(Z)-(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 2003441 |
| Molecular Formula | C18H13N5O4S2 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | [4-[(Z)-(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] methanesulfonate |
| SMILES | [H]/N=C1C(=C/c2ccc(OS(C)(=O)=O)cc2)/C(=O)N=C2SC(c3cccnc3)=NN2/1 |
| InChI | InChI=1S/C18H13N5O4S2/c1-29(25,26)27-13-6-4-11(5-7-13)9-14-15(19)23-18(21-16(14)24)28-17(22-23)12-3-2-8-20-10-12/h2-10,19H,1H3/b14-9-,19-15- |
| InChIKey | SEKHTFNFTZJYEN-BUXXSPIWSA-N |
| XLogP | 2.09 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|