C24H21FN4O6S2 — CID 56727309
[4-[(Z)-[5-imino-2-(2-methylpropylsulfonyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]-2-methoxyphenyl] 2-fluorobenzoate (PubChem CID 56727309) has the molecular formula C24H21FN4O6S2 and a molecular weight of 544.59 g/mol. Its IUPAC name is [4-[(Z)-[5-imino-2-(2-methylpropylsulfonyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]-2-methoxyphenyl] 2-fluorobenzoate.
| Compound Name | [4-[(Z)-[5-imino-2-(2-methylpropylsulfonyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]-2-methoxyphenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 56727309 |
| Molecular Formula | C24H21FN4O6S2 |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | [4-[(Z)-[5-imino-2-(2-methylpropylsulfonyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]-2-methoxyphenyl] 2-fluorobenzoate |
| SMILES | [H]/N=C1C(=C/c2ccc(OC(=O)c3ccccc3F)c(OC)c2)/C(=O)N=C2SC(S(=O)(=O)CC(C)C)=NN2/1 |
| InChI | InChI=1S/C24H21FN4O6S2/c1-13(2)12-37(32,33)24-28-29-20(26)16(21(30)27-23(29)36-24)10-14-8-9-18(19(11-14)34-3)35-22(31)15-6-4-5-7-17(15)25/h4-11,13,26H,12H2,1-3H3/b16-10-,26-20- |
| InChIKey | NQUWSQHNEMYPRX-GTCMKCKBSA-N |
| XLogP | 3.70 |
| TPSA | 138.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|