C20H13BrN4O5S2 — CID 56726960
[2-bromo-4-[(Z)-(5-imino-2-methylsulfonyl-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzoate (PubChem CID 56726960) has the molecular formula C20H13BrN4O5S2 and a molecular weight of 533.39 g/mol. Its IUPAC name is [2-bromo-4-[(Z)-(5-imino-2-methylsulfonyl-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzoate.
| Compound Name | [2-bromo-4-[(Z)-(5-imino-2-methylsulfonyl-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 56726960 |
| Molecular Formula | C20H13BrN4O5S2 |
| Molecular Weight | 533.39 g/mol |
| Exact Mass | 531.95 |
| IUPAC Name | [2-bromo-4-[(Z)-(5-imino-2-methylsulfonyl-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzoate |
| SMILES | [H]/N=C1C(=C/c2ccc(OC(=O)c3ccccc3)c(Br)c2)/C(=O)N=C2SC(S(C)(=O)=O)=NN2/1 |
| InChI | InChI=1S/C20H13BrN4O5S2/c1-32(28,29)20-24-25-16(22)13(17(26)23-19(25)31-20)9-11-7-8-15(14(21)10-11)30-18(27)12-5-3-2-4-6-12/h2-10,22H,1H3/b13-9-,22-16- |
| InChIKey | OWRNKAVILFFPDB-ZHZPIXNFSA-N |
| XLogP | 3.29 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|