C20H13BrN4O3S — CID 1294960
[2-bromo-4-[(5-imino-2-methyl-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzoate (PubChem CID 1294960) has the molecular formula C20H13BrN4O3S and a molecular weight of 469.32 g/mol. Its IUPAC name is [2-bromo-4-[(5-imino-2-methyl-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzoate.
| Compound Name | [2-bromo-4-[(5-imino-2-methyl-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 1294960 |
| Molecular Formula | C20H13BrN4O3S |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | [2-bromo-4-[(5-imino-2-methyl-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] benzoate |
| SMILES | [H]/N=C1\C(=Cc2ccc(OC(=O)c3ccccc3)c(Br)c2)C(=O)N=C2SC(C)=NN21 |
| InChI | InChI=1S/C20H13BrN4O3S/c1-11-24-25-17(22)14(18(26)23-20(25)29-11)9-12-7-8-16(15(21)10-12)28-19(27)13-5-3-2-4-6-13/h2-10,22H,1H3/b14-9?,22-17+ |
| InChIKey | XXVNRGZZYKHBJW-OATKDLJTSA-N |
| XLogP | 4.31 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|