C25H25N3O7 — CID 46254360
(6Z)-6-[[3,5-dimethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-7-imino-2-methyl-[1,2]oxazolo[2,3-a]pyrimidin-5-one (PubChem CID 46254360) has the molecular formula C25H25N3O7 and a molecular weight of 479.49 g/mol. Its IUPAC name is (6Z)-6-[[3,5-dimethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-7-imino-2-methyl-[1,2]oxazolo[2,3-a]pyrimidin-5-one.
| Compound Name | (6Z)-6-[[3,5-dimethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-7-imino-2-methyl-[1,2]oxazolo[2,3-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 46254360 |
| Molecular Formula | C25H25N3O7 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | (6Z)-6-[[3,5-dimethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-7-imino-2-methyl-[1,2]oxazolo[2,3-a]pyrimidin-5-one |
| SMILES | [H]/N=C1C(=C/c2cc(OC)c(OCCOc3ccccc3OC)c(OC)c2)/C(=O)N=C2C=C(C)ON2/1 |
| InChI | InChI=1S/C25H25N3O7/c1-15-11-22-27-25(29)17(24(26)28(22)35-15)12-16-13-20(31-3)23(21(14-16)32-4)34-10-9-33-19-8-6-5-7-18(19)30-2/h5-8,11-14,26H,9-10H2,1-4H3/b17-12-,26-24- |
| InChIKey | VZGYUXYWJDXAFF-MUTUNPRWSA-N |
| XLogP | 3.62 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|