C23H20ClN3O5 — CID 46254273
(6Z)-6-[[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]methylidene]-7-imino-2-methyl-[1,2]oxazolo[2,3-a]pyrimidin-5-one (PubChem CID 46254273) has the molecular formula C23H20ClN3O5 and a molecular weight of 453.88 g/mol. Its IUPAC name is (6Z)-6-[[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]methylidene]-7-imino-2-methyl-[1,2]oxazolo[2,3-a]pyrimidin-5-one.
| Compound Name | (6Z)-6-[[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]methylidene]-7-imino-2-methyl-[1,2]oxazolo[2,3-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 46254273 |
| Molecular Formula | C23H20ClN3O5 |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | (6Z)-6-[[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]methylidene]-7-imino-2-methyl-[1,2]oxazolo[2,3-a]pyrimidin-5-one |
| SMILES | [H]/N=C1C(=C/c2ccc(OCCOc3ccccc3Cl)c(OC)c2)/C(=O)N=C2C=C(C)ON2/1 |
| InChI | InChI=1S/C23H20ClN3O5/c1-14-11-21-26-23(28)16(22(25)27(21)32-14)12-15-7-8-19(20(13-15)29-2)31-10-9-30-18-6-4-3-5-17(18)24/h3-8,11-13,25H,9-10H2,1-2H3/b16-12-,25-22- |
| InChIKey | PHIGSEMBDWIGBC-FDXFHYOPSA-N |
| XLogP | 4.26 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|