C25H24ClN3O5 — CID 46254260
(6Z)-6-[[3-chloro-4-[2-(2,4-dimethylphenoxy)ethoxy]-5-methoxyphenyl]methylidene]-7-imino-2-methyl-[1,2]oxazolo[2,3-a]pyrimidin-5-one (PubChem CID 46254260) has the molecular formula C25H24ClN3O5 and a molecular weight of 481.94 g/mol. Its IUPAC name is (6Z)-6-[[3-chloro-4-[2-(2,4-dimethylphenoxy)ethoxy]-5-methoxyphenyl]methylidene]-7-imino-2-methyl-[1,2]oxazolo[2,3-a]pyrimidin-5-one.
| Compound Name | (6Z)-6-[[3-chloro-4-[2-(2,4-dimethylphenoxy)ethoxy]-5-methoxyphenyl]methylidene]-7-imino-2-methyl-[1,2]oxazolo[2,3-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 46254260 |
| Molecular Formula | C25H24ClN3O5 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | (6Z)-6-[[3-chloro-4-[2-(2,4-dimethylphenoxy)ethoxy]-5-methoxyphenyl]methylidene]-7-imino-2-methyl-[1,2]oxazolo[2,3-a]pyrimidin-5-one |
| SMILES | [H]/N=C1C(=C/c2cc(Cl)c(OCCOc3ccc(C)cc3C)c(OC)c2)/C(=O)N=C2C=C(C)ON2/1 |
| InChI | InChI=1S/C25H24ClN3O5/c1-14-5-6-20(15(2)9-14)32-7-8-33-23-19(26)12-17(13-21(23)31-4)11-18-24(27)29-22(28-25(18)30)10-16(3)34-29/h5-6,9-13,27H,7-8H2,1-4H3/b18-11-,27-24- |
| InChIKey | PBKQKTGIPLWNJY-HVZLUWKFSA-N |
| XLogP | 4.87 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|