C24H21N3O6 — CID 46254386
[2-ethoxy-4-[(Z)-(7-imino-2-methyl-5-oxo-[1,2]oxazolo[2,3-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methoxybenzoate (PubChem CID 46254386) has the molecular formula C24H21N3O6 and a molecular weight of 447.45 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-(7-imino-2-methyl-5-oxo-[1,2]oxazolo[2,3-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methoxybenzoate.
| Compound Name | [2-ethoxy-4-[(Z)-(7-imino-2-methyl-5-oxo-[1,2]oxazolo[2,3-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 46254386 |
| Molecular Formula | C24H21N3O6 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | [2-ethoxy-4-[(Z)-(7-imino-2-methyl-5-oxo-[1,2]oxazolo[2,3-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methoxybenzoate |
| SMILES | [H]/N=C1C(=C/c2ccc(OC(=O)c3cccc(OC)c3)c(OCC)c2)/C(=O)N=C2C=C(C)ON2/1 |
| InChI | InChI=1S/C24H21N3O6/c1-4-31-20-12-15(11-18-22(25)27-21(26-23(18)28)10-14(2)33-27)8-9-19(20)32-24(29)16-6-5-7-17(13-16)30-3/h5-13,25H,4H2,1-3H3/b18-11-,25-22- |
| InChIKey | XFTIIGQRLIHGEG-CGZJZCCVSA-N |
| XLogP | 3.76 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|