C23H18BrN3O5 — CID 46254403
[2-bromo-4-[(Z)-(7-imino-2-methyl-5-oxo-[1,2]oxazolo[2,3-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 4-methylbenzoate (PubChem CID 46254403) has the molecular formula C23H18BrN3O5 and a molecular weight of 496.32 g/mol. Its IUPAC name is [2-bromo-4-[(Z)-(7-imino-2-methyl-5-oxo-[1,2]oxazolo[2,3-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 4-methylbenzoate.
| Compound Name | [2-bromo-4-[(Z)-(7-imino-2-methyl-5-oxo-[1,2]oxazolo[2,3-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 46254403 |
| Molecular Formula | C23H18BrN3O5 |
| Molecular Weight | 496.32 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | [2-bromo-4-[(Z)-(7-imino-2-methyl-5-oxo-[1,2]oxazolo[2,3-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 4-methylbenzoate |
| SMILES | [H]/N=C1C(=C/c2cc(Br)c(OC(=O)c3ccc(C)cc3)c(OC)c2)/C(=O)N=C2C=C(C)ON2/1 |
| InChI | InChI=1S/C23H18BrN3O5/c1-12-4-6-15(7-5-12)23(29)31-20-17(24)10-14(11-18(20)30-3)9-16-21(25)27-19(26-22(16)28)8-13(2)32-27/h4-11,25H,1-3H3/b16-9-,25-21- |
| InChIKey | QHADZGBBPSNMHD-KMKKMTLJSA-N |
| XLogP | 4.44 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|