C23H20N4O5S2 — CID 46248218
[2-ethoxy-4-[(Z)-(5-imino-3-methylsulfanyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methoxybenzoate (PubChem CID 46248218) has the molecular formula C23H20N4O5S2 and a molecular weight of 496.57 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-(5-imino-3-methylsulfanyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methoxybenzoate.
| Compound Name | [2-ethoxy-4-[(Z)-(5-imino-3-methylsulfanyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 46248218 |
| Molecular Formula | C23H20N4O5S2 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | [2-ethoxy-4-[(Z)-(5-imino-3-methylsulfanyl-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methoxybenzoate |
| SMILES | [H]/N=C1C(=C/c2ccc(OC(=O)c3cccc(OC)c3)c(OCC)c2)/C(=O)N=C2SN=C(SC)N2/1 |
| InChI | InChI=1S/C23H20N4O5S2/c1-4-31-18-11-13(8-9-17(18)32-21(29)14-6-5-7-15(12-14)30-2)10-16-19(24)27-22(25-20(16)28)34-26-23(27)33-3/h5-12,24H,4H2,1-3H3/b16-10-,24-19- |
| InChIKey | HVGCOTLJYVYVCE-KMHWIDDISA-N |
| XLogP | 4.25 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|