C22H18N4O4S2 — CID 46505316
[4-[(Z)-(3-ethylsulfanyl-5-imino-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methoxybenzoate (PubChem CID 46505316) has the molecular formula C22H18N4O4S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is [4-[(Z)-(3-ethylsulfanyl-5-imino-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methoxybenzoate.
| Compound Name | [4-[(Z)-(3-ethylsulfanyl-5-imino-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 46505316 |
| Molecular Formula | C22H18N4O4S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | [4-[(Z)-(3-ethylsulfanyl-5-imino-7-oxo-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] 3-methoxybenzoate |
| SMILES | [H]/N=C1C(=C/c2ccc(OC(=O)c3cccc(OC)c3)cc2)/C(=O)N=C2SN=C(SCC)N2/1 |
| InChI | InChI=1S/C22H18N4O4S2/c1-3-31-22-25-32-21-24-19(27)17(18(23)26(21)22)11-13-7-9-15(10-8-13)30-20(28)14-5-4-6-16(12-14)29-2/h4-12,23H,3H2,1-2H3/b17-11-,23-18- |
| InChIKey | OBDVHIVBUSNPLF-ZEWFKVHTSA-N |
| XLogP | 4.24 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|