C12H10N4O2S2 — CID 4196718
3-ethylsulfanyl-6-(furan-2-ylmethylidene)-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one (PubChem CID 4196718) has the molecular formula C12H10N4O2S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 3-ethylsulfanyl-6-(furan-2-ylmethylidene)-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one.
| Compound Name | 3-ethylsulfanyl-6-(furan-2-ylmethylidene)-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4196718 |
| Molecular Formula | C12H10N4O2S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 3-ethylsulfanyl-6-(furan-2-ylmethylidene)-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccco2)C(=O)N=C2SN=C(SCC)N21 |
| InChI | InChI=1S/C12H10N4O2S2/c1-2-19-12-15-20-11-14-10(17)8(9(13)16(11)12)6-7-4-3-5-18-7/h3-6,13H,2H2,1H3/b8-6?,13-9+ |
| InChIKey | ZICGBJIUESFIKQ-AIWHIMKQSA-N |
| XLogP | 2.61 |
| TPSA | 82.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|