C12H9N5OS2 — CID 5203282
5-imino-3-methylsulfanyl-6-(pyridin-3-ylmethylidene)-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one (PubChem CID 5203282) has the molecular formula C12H9N5OS2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 5-imino-3-methylsulfanyl-6-(pyridin-3-ylmethylidene)-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one.
| Compound Name | 5-imino-3-methylsulfanyl-6-(pyridin-3-ylmethylidene)-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 5203282 |
| Molecular Formula | C12H9N5OS2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 5-imino-3-methylsulfanyl-6-(pyridin-3-ylmethylidene)-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2cccnc2)C(=O)N=C2SN=C(SC)N21 |
| InChI | InChI=1S/C12H9N5OS2/c1-19-12-16-20-11-15-10(18)8(9(13)17(11)12)5-7-3-2-4-14-6-7/h2-6,13H,1H3/b8-5?,13-9+ |
| InChIKey | MJRYGDUENGLINS-WMHQSUSYSA-N |
| XLogP | 2.02 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|