C17H11ClN4O2S3 — CID 46505225
(6Z)-6-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-5-imino-3-methylsulfanyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one (PubChem CID 46505225) has the molecular formula C17H11ClN4O2S3 and a molecular weight of 434.96 g/mol. Its IUPAC name is (6Z)-6-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-5-imino-3-methylsulfanyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-5-imino-3-methylsulfanyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46505225 |
| Molecular Formula | C17H11ClN4O2S3 |
| Molecular Weight | 434.96 g/mol |
| Exact Mass | 433.97 |
| IUPAC Name | (6Z)-6-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-5-imino-3-methylsulfanyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2ccc(Sc3ccc(Cl)cc3)o2)/C(=O)N=C2SN=C(SC)N2/1 |
| InChI | InChI=1S/C17H11ClN4O2S3/c1-25-17-21-27-16-20-15(23)12(14(19)22(16)17)8-10-4-7-13(24-10)26-11-5-2-9(18)3-6-11/h2-8,19H,1H3/b12-8-,19-14- |
| InChIKey | IUGLZJXBBHFYLV-ZEQMLXSTSA-N |
| XLogP | 5.02 |
| TPSA | 82.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.96 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|