C23H14Cl2N4O2S2 — CID 3824337
3-benzylsulfanyl-6-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one (PubChem CID 3824337) has the molecular formula C23H14Cl2N4O2S2 and a molecular weight of 513.43 g/mol. Its IUPAC name is 3-benzylsulfanyl-6-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one.
| Compound Name | 3-benzylsulfanyl-6-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3824337 |
| Molecular Formula | C23H14Cl2N4O2S2 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 511.99 |
| IUPAC Name | 3-benzylsulfanyl-6-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(-c3ccc(Cl)c(Cl)c3)o2)C(=O)N=C2SN=C(SCc3ccccc3)N21 |
| InChI | InChI=1S/C23H14Cl2N4O2S2/c24-17-8-6-14(10-18(17)25)19-9-7-15(31-19)11-16-20(26)29-22(27-21(16)30)33-28-23(29)32-12-13-4-2-1-3-5-13/h1-11,26H,12H2/b16-11?,26-20+ |
| InChIKey | ZFAJHODSPPJCCI-LYZRZONPSA-N |
| XLogP | 6.76 |
| TPSA | 82.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|