C23H15ClN4O4S2 — CID 46252308
(6Z)-3-benzylsulfonyl-6-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one (PubChem CID 46252308) has the molecular formula C23H15ClN4O4S2 and a molecular weight of 510.98 g/mol. Its IUPAC name is (6Z)-3-benzylsulfonyl-6-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one.
| Compound Name | (6Z)-3-benzylsulfonyl-6-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46252308 |
| Molecular Formula | C23H15ClN4O4S2 |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | (6Z)-3-benzylsulfonyl-6-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2ccc(-c3cccc(Cl)c3)o2)\C(=O)N=C2SN=C(S(=O)(=O)Cc3ccccc3)N2\1 |
| InChI | InChI=1S/C23H15ClN4O4S2/c24-16-8-4-7-15(11-16)19-10-9-17(32-19)12-18-20(25)28-22(26-21(18)29)33-27-23(28)34(30,31)13-14-5-2-1-3-6-14/h1-12,25H,13H2/b18-12-,25-20+ |
| InChIKey | KBGQWVLSQKRZGT-PVKNPHTKSA-N |
| XLogP | 4.79 |
| TPSA | 116.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|