C17H9N4O4S- — CID 7316181
3-[5-[(E)-(5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 7316181) has the molecular formula C17H9N4O4S- and a molecular weight of 365.35 g/mol. Its IUPAC name is 3-[5-[(E)-(5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | 3-[5-[(E)-(5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 7316181 |
| Molecular Formula | C17H9N4O4S- |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 3-[5-[(E)-(5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | [H]/N=C1C(=C\c2ccc(-c3cccc(C(=O)[O-])c3)o2)/C(=O)N=C2SC=NN2/1 |
| InChI | InChI=1S/C17H10N4O4S/c18-14-12(15(22)20-17-21(14)19-8-26-17)7-11-4-5-13(25-11)9-2-1-3-10(6-9)16(23)24/h1-8,18H,(H,23,24)/p-1/b12-7+,18-14- |
| InChIKey | GASFUAMXCPRLON-ACGFKXLJSA-M |
| XLogP | 1.56 |
| TPSA | 122.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|