C15H9N2O4S- — CID 7453038
3-[5-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 7453038) has the molecular formula C15H9N2O4S- and a molecular weight of 313.31 g/mol. Its IUPAC name is 3-[5-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | 3-[5-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 7453038 |
| Molecular Formula | C15H9N2O4S- |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 3-[5-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | NC1=NC(=O)/C(=C\c2ccc(-c3cccc(C(=O)[O-])c3)o2)S1 |
| InChI | InChI=1S/C15H10N2O4S/c16-15-17-13(18)12(22-15)7-10-4-5-11(21-10)8-2-1-3-9(6-8)14(19)20/h1-7H,(H,19,20)(H2,16,17,18)/p-1/b12-7+ |
| InChIKey | VGCYMHSDDYOPIT-KPKJPENVSA-M |
| XLogP | 1.24 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|