C18H13ClN2O4S — CID 3146403
prop-2-enyl 5-[5-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate (PubChem CID 3146403) has the molecular formula C18H13ClN2O4S and a molecular weight of 388.83 g/mol. Its IUPAC name is prop-2-enyl 5-[5-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate.
| Compound Name | prop-2-enyl 5-[5-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 3146403 |
| Molecular Formula | C18H13ClN2O4S |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | prop-2-enyl 5-[5-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate |
| SMILES | C=CCOC(=O)c1cc(-c2ccc(C=C3SC(N)=NC3=O)o2)ccc1Cl |
| InChI | InChI=1S/C18H13ClN2O4S/c1-2-7-24-17(23)12-8-10(3-5-13(12)19)14-6-4-11(25-14)9-15-16(22)21-18(20)26-15/h2-6,8-9H,1,7H2,(H2,20,21,22) |
| InChIKey | FKXIZHQBLBZVCK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|