C22H15ClN2O5 — CID 3157079
prop-2-enyl 2-chloro-5-[5-[(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate (PubChem CID 3157079) has the molecular formula C22H15ClN2O5 and a molecular weight of 422.82 g/mol. Its IUPAC name is prop-2-enyl 2-chloro-5-[5-[(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate.
| Compound Name | prop-2-enyl 2-chloro-5-[5-[(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 3157079 |
| Molecular Formula | C22H15ClN2O5 |
| Molecular Weight | 422.82 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | prop-2-enyl 2-chloro-5-[5-[(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
| SMILES | C=CCOC(=O)c1cc(-c2ccc(C=C3C(=O)NC(=O)C(C#N)=C3C)o2)ccc1Cl |
| InChI | InChI=1S/C22H15ClN2O5/c1-3-8-29-22(28)16-9-13(4-6-18(16)23)19-7-5-14(30-19)10-15-12(2)17(11-24)21(27)25-20(15)26/h3-7,9-10H,1,8H2,2H3,(H,25,26,27) |
| InChIKey | IHNUNBMIRZNLFC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.82 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|