C23H19BrN2O5 — CID 50884093
butyl 5-bromo-2-[5-[(Z)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate (PubChem CID 50884093) has the molecular formula C23H19BrN2O5 and a molecular weight of 483.32 g/mol. Its IUPAC name is butyl 5-bromo-2-[5-[(Z)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate.
| Compound Name | butyl 5-bromo-2-[5-[(Z)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 50884093 |
| Molecular Formula | C23H19BrN2O5 |
| Molecular Weight | 483.32 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | butyl 5-bromo-2-[5-[(Z)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1cc(Br)ccc1-c1ccc(/C=C2\C(=O)NC(=O)C(C#N)=C2C)o1 |
| InChI | InChI=1S/C23H19BrN2O5/c1-3-4-9-30-23(29)18-10-14(24)5-7-16(18)20-8-6-15(31-20)11-17-13(2)19(12-25)22(28)26-21(17)27/h5-8,10-11H,3-4,9H2,1-2H3,(H,26,27,28)/b17-11- |
| InChIKey | FWFJUBFEQHQJFT-BOPFTXTBSA-N |
| XLogP | 4.55 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|