C26H17BrN2O5 — CID 50884251
benzyl 5-bromo-2-[5-[(Z)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate (PubChem CID 50884251) has the molecular formula C26H17BrN2O5 and a molecular weight of 517.34 g/mol. Its IUPAC name is benzyl 5-bromo-2-[5-[(Z)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate.
| Compound Name | benzyl 5-bromo-2-[5-[(Z)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 50884251 |
| Molecular Formula | C26H17BrN2O5 |
| Molecular Weight | 517.34 g/mol |
| Exact Mass | 516.03 |
| IUPAC Name | benzyl 5-bromo-2-[5-[(Z)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
| SMILES | CC1=C(C#N)C(=O)NC(=O)/C1=C\c1ccc(-c2ccc(Br)cc2C(=O)OCc2ccccc2)o1 |
| InChI | InChI=1S/C26H17BrN2O5/c1-15-20(24(30)29-25(31)22(15)13-28)12-18-8-10-23(34-18)19-9-7-17(27)11-21(19)26(32)33-14-16-5-3-2-4-6-16/h2-12H,14H2,1H3,(H,29,30,31)/b20-12- |
| InChIKey | CUZDFELDBBQFBV-NDENLUEZSA-N |
| XLogP | 4.95 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|