C26H17ClN2O5 — CID 6264757
benzyl 2-chloro-5-[5-[(E)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate (PubChem CID 6264757) has the molecular formula C26H17ClN2O5 and a molecular weight of 472.88 g/mol. Its IUPAC name is benzyl 2-chloro-5-[5-[(E)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate.
| Compound Name | benzyl 2-chloro-5-[5-[(E)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6264757 |
| Molecular Formula | C26H17ClN2O5 |
| Molecular Weight | 472.88 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | benzyl 2-chloro-5-[5-[(E)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
| SMILES | CC1=C(C#N)C(=O)NC(=O)/C1=C/c1ccc(-c2ccc(Cl)c(C(=O)OCc3ccccc3)c2)o1 |
| InChI | InChI=1S/C26H17ClN2O5/c1-15-19(24(30)29-25(31)21(15)13-28)12-18-8-10-23(34-18)17-7-9-22(27)20(11-17)26(32)33-14-16-5-3-2-4-6-16/h2-12H,14H2,1H3,(H,29,30,31)/b19-12+ |
| InChIKey | VTEWGMLHNUCZMN-XDHOZWIPSA-N |
| XLogP | 4.84 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.88 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|