C27H19ClN2O5 — CID 50884029
2-chloro-5-[5-[(E)-[5-cyano-4-methyl-2,6-dioxo-1-(2-phenylethyl)-3-pyridinylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 50884029) has the molecular formula C27H19ClN2O5 and a molecular weight of 486.91 g/mol. Its IUPAC name is 2-chloro-5-[5-[(E)-[5-cyano-4-methyl-2,6-dioxo-1-(2-phenylethyl)-3-pyridinylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-[(E)-[5-cyano-4-methyl-2,6-dioxo-1-(2-phenylethyl)-3-pyridinylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 50884029 |
| Molecular Formula | C27H19ClN2O5 |
| Molecular Weight | 486.91 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 2-chloro-5-[5-[(E)-[5-cyano-4-methyl-2,6-dioxo-1-(2-phenylethyl)-3-pyridinylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | CC1=C(C#N)C(=O)N(CCc2ccccc2)C(=O)/C1=C/c1ccc(-c2ccc(Cl)c(C(=O)O)c2)o1 |
| InChI | InChI=1S/C27H19ClN2O5/c1-16-20(14-19-8-10-24(35-19)18-7-9-23(28)21(13-18)27(33)34)25(31)30(26(32)22(16)15-29)12-11-17-5-3-2-4-6-17/h2-10,13-14H,11-12H2,1H3,(H,33,34)/b20-14+ |
| InChIKey | BKSKRLKISGEEMG-XSFVSMFZSA-N |
| XLogP | 5.13 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.91 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|