C21H17ClN2O3 — CID 19109743
(5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxo-1-propylpyridine-3-carbonitrile (PubChem CID 19109743) has the molecular formula C21H17ClN2O3 and a molecular weight of 380.83 g/mol. Its IUPAC name is (5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxo-1-propylpyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxo-1-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19109743 |
| Molecular Formula | C21H17ClN2O3 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxo-1-propylpyridine-3-carbonitrile |
| SMILES | CCCN1C(=O)C(C#N)=C(C)/C(=C\c2ccc(-c3ccccc3Cl)o2)C1=O |
| InChI | InChI=1S/C21H17ClN2O3/c1-3-10-24-20(25)16(13(2)17(12-23)21(24)26)11-14-8-9-19(27-14)15-6-4-5-7-18(15)22/h4-9,11H,3,10H2,1-2H3/b16-11+ |
| InChIKey | BBNDYPACXJODOJ-LFIBNONCSA-N |
| XLogP | 4.60 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|