C23H19ClN2O5 — CID 19113634
3-[(3E)-3-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-5-cyano-4-methyl-2,6-dioxo-1-pyridinyl]propyl acetate (PubChem CID 19113634) has the molecular formula C23H19ClN2O5 and a molecular weight of 438.87 g/mol. Its IUPAC name is 3-[(3E)-3-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-5-cyano-4-methyl-2,6-dioxo-1-pyridinyl]propyl acetate.
| Compound Name | 3-[(3E)-3-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-5-cyano-4-methyl-2,6-dioxo-1-pyridinyl]propyl acetate |
|---|---|
| PubChem CID | 19113634 |
| Molecular Formula | C23H19ClN2O5 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 3-[(3E)-3-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-5-cyano-4-methyl-2,6-dioxo-1-pyridinyl]propyl acetate |
| SMILES | CC(=O)OCCCN1C(=O)C(C#N)=C(C)/C(=C\c2ccc(-c3ccccc3Cl)o2)C1=O |
| InChI | InChI=1S/C23H19ClN2O5/c1-14-18(12-16-8-9-21(31-16)17-6-3-4-7-20(17)24)22(28)26(23(29)19(14)13-25)10-5-11-30-15(2)27/h3-4,6-9,12H,5,10-11H2,1-2H3/b18-12+ |
| InChIKey | JBDKNBMAFPUQBH-LDADJPATSA-N |
| XLogP | 4.15 |
| TPSA | 100.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|