C25H15Cl2FN2O3 — CID 19113222
(5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1-[(4-fluorophenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19113222) has the molecular formula C25H15Cl2FN2O3 and a molecular weight of 481.31 g/mol. Its IUPAC name is (5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1-[(4-fluorophenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1-[(4-fluorophenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19113222 |
| Molecular Formula | C25H15Cl2FN2O3 |
| Molecular Weight | 481.31 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | (5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1-[(4-fluorophenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(Cc2ccc(F)cc2)C(=O)/C1=C/c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C25H15Cl2FN2O3/c1-14-19(11-18-7-9-23(33-18)20-10-16(26)4-8-22(20)27)24(31)30(25(32)21(14)12-29)13-15-2-5-17(28)6-3-15/h2-11H,13H2,1H3/b19-11+ |
| InChIKey | CJCTULNUBCKNKT-YBFXNURJSA-N |
| XLogP | 6.18 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.31 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|