C27H17ClN2O5 — CID 50888802
(5E)-1-[(4-chlorophenyl)methyl]-4-methyl-2,6-dioxo-5-[[5-(3-oxo-1H-2-benzofuran-5-yl)furan-2-yl]methylidene]pyridine-3-carbonitrile (PubChem CID 50888802) has the molecular formula C27H17ClN2O5 and a molecular weight of 484.90 g/mol. Its IUPAC name is (5E)-1-[(4-chlorophenyl)methyl]-4-methyl-2,6-dioxo-5-[[5-(3-oxo-1H-2-benzofuran-5-yl)furan-2-yl]methylidene]pyridine-3-carbonitrile.
| Compound Name | (5E)-1-[(4-chlorophenyl)methyl]-4-methyl-2,6-dioxo-5-[[5-(3-oxo-1H-2-benzofuran-5-yl)furan-2-yl]methylidene]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 50888802 |
| Molecular Formula | C27H17ClN2O5 |
| Molecular Weight | 484.90 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | (5E)-1-[(4-chlorophenyl)methyl]-4-methyl-2,6-dioxo-5-[[5-(3-oxo-1H-2-benzofuran-5-yl)furan-2-yl]methylidene]pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(Cc2ccc(Cl)cc2)C(=O)/C1=C/c1ccc(-c2ccc3c(c2)C(=O)OC3)o1 |
| InChI | InChI=1S/C27H17ClN2O5/c1-15-21(25(31)30(26(32)23(15)12-29)13-16-2-6-19(28)7-3-16)11-20-8-9-24(35-20)17-4-5-18-14-34-27(33)22(18)10-17/h2-11H,13-14H2,1H3/b21-11+ |
| InChIKey | OAGORKCFLUMMTH-SRZZPIQSSA-N |
| XLogP | 5.06 |
| TPSA | 100.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.90 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|