C23H17N3O5 — CID 50885519
(5E)-5-[[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylidene]-4-methyl-2,6-dioxo-1-propylpyridine-3-carbonitrile (PubChem CID 50885519) has the molecular formula C23H17N3O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is (5E)-5-[[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylidene]-4-methyl-2,6-dioxo-1-propylpyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylidene]-4-methyl-2,6-dioxo-1-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 50885519 |
| Molecular Formula | C23H17N3O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (5E)-5-[[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylidene]-4-methyl-2,6-dioxo-1-propylpyridine-3-carbonitrile |
| SMILES | CCCN1C(=O)C(C#N)=C(C)/C(=C\c2ccc(-c3ccc4c(c3)C(=O)NC4=O)o2)C1=O |
| InChI | InChI=1S/C23H17N3O5/c1-3-8-26-22(29)16(12(2)18(11-24)23(26)30)10-14-5-7-19(31-14)13-4-6-15-17(9-13)21(28)25-20(15)27/h4-7,9-10H,3,8H2,1-2H3,(H,25,27,28)/b16-10+ |
| InChIKey | LUZMMUNGQFEKBT-MHWRWJLKSA-N |
| XLogP | 2.83 |
| TPSA | 120.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|